What is structure of 4 ethyl octane?
Formula: C10H22. Molecular weight: 142.2817. IUPAC Standard InChI: InChI=1S/C10H22/c1-4-7-9-10(6-3)8-5-2/h10H,4-9H2,1-3H3. IUPAC Standard InChIKey: NRJUFUBKIFIKFI-UHFFFAOYSA-N.
What is the structural formula for 3 octane?
Octane is a hydrocarbon and an alkane with the chemical formula C 8H 18, and the condensed structural formula CH 3(CH 2) 6CH 3.
…
Octane.
| Names | |
|---|---|
| Density | 0.703 g/cm3 |
| Melting point | −57.1 to −56.6 °C; −70.9 to −69.8 °F; 216.0 to 216.6 K |
| Boiling point | 125.1 to 126.1 °C; 257.1 to 258.9 °F; 398.2 to 399.2 K |
What is the complete structural formula of octane?
Octane is a hydrocarbon and an alkane with the chemical formula C8H18, and the condensed structural formula CH3(CH2)6CH3.
What is the structure of 4-Propyloctane?
Identification of 4-propyloctane Chemical Compound
| Chemical Formula | C11H24 |
|---|---|
| IUPAC Name | 4-propyloctane |
| SMILES String | CCCCC(CCC)CCC |
| InChI | InChI=1S/C11H24/c1-4-7-10-11(8-5-2)9-6-3/h11H,4-10H2,1-3H3 |
| InChIKey | VFAMBAFLNKONTN-UHFFFAOYSA-N |
What is C10H22 called?
Decane
Decane is an alkane hydrocarbon with the chemical formula C10H22.
What is the structural formula for 3 Ethylpentane?
C7H163-Ethylpentane / Formula
How do you draw 3-Methyloctane?
How to draw the structure for 3-methylheptane | Alkanes – YouTube
Why is octane called octane?
The name “octane” comes from the following fact: When you take crude oil and “crack” it in a refinery, you end up getting hydrocarbon chains of different lengths. These different chain lengths can then be separated from each other and blended to form different fuels.
What is the symbol for octane?
C₈H₁₈Octane / Formula
What is the condensed structural formula for 4-Propyloctane?
C11H24
Identification of 4-propyloctane Chemical Compound
| Chemical Formula | C11H24 |
|---|---|
| IUPAC Name | 4-propyloctane |
| SMILES String | CCCCC(CCC)CCC |
| InChI | InChI=1S/C11H24/c1-4-7-10-11(8-5-2)9-6-3/h11H,4-10H2,1-3H3 |
| InChIKey | VFAMBAFLNKONTN-UHFFFAOYSA-N |
What is the molecular formula for the hydrocarbon compound 4-Propyloctane?
4-Propyloctane | C11H24 | ChemSpider.
What is c12h22?
Bicyclohexyl, also known as dicyclohexyl or bicyclohexane, is an organic chemical with the formula C12H22 and a molecular mass of 166.303 g mol−1. It is a nonvolatile liquid at room temperature, with a boiling point of 227 °C (441 °F).
What is C3H7?
Isopropyl radical | C3H7 – PubChem.
What is the structure of 2 Ethylpentane?
2-Ethylpentane-1,5-diol
| PubChem CID | 18522833 |
|---|---|
| Structure | Find Similar Structures |
| Molecular Formula | C7H16O2 |
| Synonyms | 2-Ethylpentane-1,5-diol SCHEMBL964900 14189-13-0 |
| Molecular Weight | 132.20 |
What is isomer 3 Ethylpentane?
3-Ethylpentane (C7H16) is a branched saturated hydrocarbon. It is an alkane, and one of the many structural isomers of heptane, consisting of a five carbon chain with a two carbon branch at the middle carbon.
What is the structure of 4 Methylheptane?
4-Methylheptane
| PubChem CID | 11512 |
|---|---|
| Structure | Find Similar Structures |
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C8H18 |
| Synonyms | 4-METHYLHEPTANE 589-53-7 Heptane, 4-methyl- 4-methyl-heptane UNII-N6BX267ALB More… |
Is 2 Methylheptane an alkane?
2-Methylheptane is a branched alkane isomeric to octane. Its structural formula is (CH3)2CH(CH2)4CH3.
What octane is jet fuel?
The octane ratings of AVGAS, a gasoline-based fuel, are usually either 91 or 100 (lean mixture) and 96 or 130 (rich mixture). The octane rating of jet fuel is much lower, around 15 – this is much more like automotive diesel and thus much more resistant to detonating due to sparks or compression.
Is petrol A octane?
Motor Gasoline Regular (marketed as “Petrol”) which has RON 80 rating, and Motor Gasoline Premium (marketed as “Octane”) which has RON 95 rating.
How do you draw a structural formula?
Covalent Bonds: How to draw the structural formula and – YouTube
What is condensed structural formula?
A condensed structural formula is a system of writing organic structures in a line of text. It shows all atoms, but omits the vertical bonds and most or all the horizontal single bonds. The condensed structural formulas of ethane, propane, and ethanol are. CH₃CH₃, CH₃CH₂CH₃, and CH₃CH₂OH.
What does 2c12h22o11 mean?
Acronym. Definition. C12H22O11. Table Sugar (sucrose; common chemical formula) Copyright 1988-2018 AcronymFinder.com, All rights reserved.
What is c6h22o11?
Glucose – C6H12O6. Lactose – C12H22O11. Inositol – C6H12O6.
What is c3 h7 called?
What is the name of c4 h9?
1-Butyl radical
1-Butyl radical
| PubChem CID | 137616 |
|---|---|
| Molecular Formula | C4H9 |
| Synonyms | 1-Butyl radical 2492-36-6 Butyl radical n-C4H9 DTXSID00179629 |
| Molecular Weight | 57.11 |
| Dates | Modify 2022-09-24 Create 2005-08-08 |